C14H13N3O3S — CID 9066302
methyl 3-[2-(cyanomethylsulfanyl)-4-oxoquinazolin-3-yl]propanoate (PubChem CID 9066302) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is methyl 3-[2-(cyanomethylsulfanyl)-4-oxoquinazolin-3-yl]propanoate.
| Compound Name | methyl 3-[2-(cyanomethylsulfanyl)-4-oxoquinazolin-3-yl]propanoate |
|---|---|
| PubChem CID | 9066302 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | methyl 3-[2-(cyanomethylsulfanyl)-4-oxoquinazolin-3-yl]propanoate |
| SMILES | COC(=O)CCn1c(SCC#N)nc2ccccc2c1=O |
| InChI | InChI=1S/C14H13N3O3S/c1-20-12(18)6-8-17-13(19)10-4-2-3-5-11(10)16-14(17)21-9-7-15/h2-5H,6,8-9H2,1H3 |
| InChIKey | ACJQGBLHDBEDIQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |