C17H23N4OS+ — CID 9375415
3-[2-(cyanomethylsulfanyl)-4-oxoquinazolin-3-yl]propyl-diethylazanium (PubChem CID 9375415) has the molecular formula C17H23N4OS+ and a molecular weight of 331.47 g/mol. Its IUPAC name is 3-[2-(cyanomethylsulfanyl)-4-oxoquinazolin-3-yl]propyl-diethylazanium.
| Compound Name | 3-[2-(cyanomethylsulfanyl)-4-oxoquinazolin-3-yl]propyl-diethylazanium |
|---|---|
| PubChem CID | 9375415 |
| Molecular Formula | C17H23N4OS+ |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 3-[2-(cyanomethylsulfanyl)-4-oxoquinazolin-3-yl]propyl-diethylazanium |
| SMILES | CC[NH+](CC)CCCn1c(SCC#N)nc2ccccc2c1=O |
| InChI | InChI=1S/C17H22N4OS/c1-3-20(4-2)11-7-12-21-16(22)14-8-5-6-9-15(14)19-17(21)23-13-10-18/h5-6,8-9H,3-4,7,11-13H2,1-2H3/p+1 |
| InChIKey | WAYFYRLPFXDBJT-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 63.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |