C18H16N4O3S2 — CID 7875313
4-[2-[2-(cyanomethylsulfanyl)-4-oxoquinazolin-3-yl]ethyl]benzenesulfonamide (PubChem CID 7875313) has the molecular formula C18H16N4O3S2 and a molecular weight of 400.49 g/mol. Its IUPAC name is 4-[2-[2-(cyanomethylsulfanyl)-4-oxoquinazolin-3-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[2-(cyanomethylsulfanyl)-4-oxoquinazolin-3-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7875313 |
| Molecular Formula | C18H16N4O3S2 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 4-[2-[2-(cyanomethylsulfanyl)-4-oxoquinazolin-3-yl]ethyl]benzenesulfonamide |
| SMILES | N#CCSc1nc2ccccc2c(=O)n1CCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C18H16N4O3S2/c19-10-12-26-18-21-16-4-2-1-3-15(16)17(23)22(18)11-9-13-5-7-14(8-6-13)27(20,24)25/h1-8H,9,11-12H2,(H2,20,24,25) |
| InChIKey | SSOMKXSIVVIVPQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |