C26H24ClN5O4S2 — CID 155814228
N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-[4-oxo-3-[2-(4-sulfamoylphenyl)ethyl]quinazolin-2-yl]sulfanylacetamide (PubChem CID 155814228) has the molecular formula C26H24ClN5O4S2 and a molecular weight of 570.10 g/mol. Its IUPAC name is N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-[4-oxo-3-[2-(4-sulfamoylphenyl)ethyl]quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-[4-oxo-3-[2-(4-sulfamoylphenyl)ethyl]quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 155814228 |
| Molecular Formula | C26H24ClN5O4S2 |
| Molecular Weight | 570.10 g/mol |
| Exact Mass | 569.10 |
| IUPAC Name | N-[(E)-1-(4-chlorophenyl)ethylideneamino]-2-[4-oxo-3-[2-(4-sulfamoylphenyl)ethyl]quinazolin-2-yl]sulfanylacetamide |
| SMILES | C/C(=N\NC(=O)CSc1nc2ccccc2c(=O)n1CCc1ccc(S(N)(=O)=O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H24ClN5O4S2/c1-17(19-8-10-20(27)11-9-19)30-31-24(33)16-37-26-29-23-5-3-2-4-22(23)25(34)32(26)15-14-18-6-12-21(13-7-18)38(28,35)36/h2-13H,14-16H2,1H3,(H,31,33)(H2,28,35,36)/b30-17+ |
| InChIKey | QUWHSUKQWXBVNJ-OCSSWDANSA-N |
| XLogP | 3.57 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.10 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|