C28H29N5O6S2 — CID 165416988
N-[(E)-1-(2,5-dimethoxyphenyl)ethylideneamino]-2-[4-oxo-3-[2-(4-sulfamoylphenyl)ethyl]quinazolin-2-yl]sulfanylacetamide (PubChem CID 165416988) has the molecular formula C28H29N5O6S2 and a molecular weight of 595.70 g/mol. Its IUPAC name is N-[(E)-1-(2,5-dimethoxyphenyl)ethylideneamino]-2-[4-oxo-3-[2-(4-sulfamoylphenyl)ethyl]quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-[(E)-1-(2,5-dimethoxyphenyl)ethylideneamino]-2-[4-oxo-3-[2-(4-sulfamoylphenyl)ethyl]quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 165416988 |
| Molecular Formula | C28H29N5O6S2 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.16 |
| IUPAC Name | N-[(E)-1-(2,5-dimethoxyphenyl)ethylideneamino]-2-[4-oxo-3-[2-(4-sulfamoylphenyl)ethyl]quinazolin-2-yl]sulfanylacetamide |
| SMILES | COc1ccc(OC)c(/C(C)=N/NC(=O)CSc2nc3ccccc3c(=O)n2CCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C28H29N5O6S2/c1-18(23-16-20(38-2)10-13-25(23)39-3)31-32-26(34)17-40-28-30-24-7-5-4-6-22(24)27(35)33(28)15-14-19-8-11-21(12-9-19)41(29,36)37/h4-13,16H,14-15,17H2,1-3H3,(H,32,34)(H2,29,36,37)/b31-18+ |
| InChIKey | WDNKOVDIHNMTGD-FDAWAROLSA-N |
| XLogP | 2.94 |
| TPSA | 154.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|