C25H22N4O4S — CID 1400610
N-[1-(2-hydroxyphenyl)ethylideneamino]-2-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 1400610) has the molecular formula C25H22N4O4S and a molecular weight of 474.54 g/mol. Its IUPAC name is N-[1-(2-hydroxyphenyl)ethylideneamino]-2-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-[1-(2-hydroxyphenyl)ethylideneamino]-2-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 1400610 |
| Molecular Formula | C25H22N4O4S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | N-[1-(2-hydroxyphenyl)ethylideneamino]-2-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | COc1ccc(-n2c(SCC(=O)NN=C(C)c3ccccc3O)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C25H22N4O4S/c1-16(19-7-4-6-10-22(19)30)27-28-23(31)15-34-25-26-21-9-5-3-8-20(21)24(32)29(25)17-11-13-18(33-2)14-12-17/h3-14,30H,15H2,1-2H3,(H,28,31) |
| InChIKey | RYINVIUMFGFONS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|