C18H16N4O4S — CID 7253259
N-carbamoyl-2-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 7253259) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is N-carbamoyl-2-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-carbamoyl-2-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 7253259 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-carbamoyl-2-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | COc1ccc(-n2c(SCC(=O)NC(N)=O)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C18H16N4O4S/c1-26-12-8-6-11(7-9-12)22-16(24)13-4-2-3-5-14(13)20-18(22)27-10-15(23)21-17(19)25/h2-9H,10H2,1H3,(H3,19,21,23,25) |
| InChIKey | DFUNRLWPZUPGFR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |