C24H24N4O2S — CID 15997017
2-[4-oxo-3-(2-phenylethyl)-7-(piperidine-1-carbonyl)quinazolin-2-yl]sulfanylacetonitrile (PubChem CID 15997017) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-[4-oxo-3-(2-phenylethyl)-7-(piperidine-1-carbonyl)quinazolin-2-yl]sulfanylacetonitrile.
| Compound Name | 2-[4-oxo-3-(2-phenylethyl)-7-(piperidine-1-carbonyl)quinazolin-2-yl]sulfanylacetonitrile |
|---|---|
| PubChem CID | 15997017 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 2-[4-oxo-3-(2-phenylethyl)-7-(piperidine-1-carbonyl)quinazolin-2-yl]sulfanylacetonitrile |
| SMILES | N#CCSc1nc2cc(C(=O)N3CCCCC3)ccc2c(=O)n1CCc1ccccc1 |
| InChI | InChI=1S/C24H24N4O2S/c25-12-16-31-24-26-21-17-19(22(29)27-13-5-2-6-14-27)9-10-20(21)23(30)28(24)15-11-18-7-3-1-4-8-18/h1,3-4,7-10,17H,2,5-6,11,13-16H2 |
| InChIKey | QAGNDPWKXDRNRH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |