C29H29N3O2S — CID 32974559
3-(3-phenylpropyl)-2-[[4-(pyrrolidine-1-carbonyl)phenyl]methylsulfanyl]quinazolin-4-one (PubChem CID 32974559) has the molecular formula C29H29N3O2S and a molecular weight of 483.64 g/mol. Its IUPAC name is 3-(3-phenylpropyl)-2-[[4-(pyrrolidine-1-carbonyl)phenyl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(3-phenylpropyl)-2-[[4-(pyrrolidine-1-carbonyl)phenyl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 32974559 |
| Molecular Formula | C29H29N3O2S |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 3-(3-phenylpropyl)-2-[[4-(pyrrolidine-1-carbonyl)phenyl]methylsulfanyl]quinazolin-4-one |
| SMILES | O=C(c1ccc(CSc2nc3ccccc3c(=O)n2CCCc2ccccc2)cc1)N1CCCC1 |
| InChI | InChI=1S/C29H29N3O2S/c33-27(31-18-6-7-19-31)24-16-14-23(15-17-24)21-35-29-30-26-13-5-4-12-25(26)28(34)32(29)20-8-11-22-9-2-1-3-10-22/h1-5,9-10,12-17H,6-8,11,18-21H2 |
| InChIKey | XVCXIKLYZOZKCT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |