C28H28N4O5S — CID 146052871
[4-[(3-benzylimidazo[4,5-b]pyridin-2-yl)sulfanylmethyl]phenyl]-piperidin-1-ylmethanone;oxalic acid (PubChem CID 146052871) has the molecular formula C28H28N4O5S and a molecular weight of 532.62 g/mol. Its IUPAC name is [4-[(3-benzylimidazo[4,5-b]pyridin-2-yl)sulfanylmethyl]phenyl]-piperidin-1-ylmethanone;oxalic acid.
| Compound Name | [4-[(3-benzylimidazo[4,5-b]pyridin-2-yl)sulfanylmethyl]phenyl]-piperidin-1-ylmethanone;oxalic acid |
|---|---|
| PubChem CID | 146052871 |
| Molecular Formula | C28H28N4O5S |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | [4-[(3-benzylimidazo[4,5-b]pyridin-2-yl)sulfanylmethyl]phenyl]-piperidin-1-ylmethanone;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(c1ccc(CSc2nc3cccnc3n2Cc2ccccc2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C26H26N4OS.C2H2O4/c31-25(29-16-5-2-6-17-29)22-13-11-21(12-14-22)19-32-26-28-23-10-7-15-27-24(23)30(26)18-20-8-3-1-4-9-20;3-1(4)2(5)6/h1,3-4,7-15H,2,5-6,16-19H2;(H,3,4)(H,5,6) |
| InChIKey | CNMGUMWKIZFGTH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|