C29H30N4O5S — CID 146051882
[4-[(3-benzylimidazo[4,5-b]pyridin-2-yl)sulfanylmethyl]phenyl]-(3-methylpiperidin-1-yl)methanone;oxalic acid (PubChem CID 146051882) has the molecular formula C29H30N4O5S and a molecular weight of 546.65 g/mol. Its IUPAC name is [4-[(3-benzylimidazo[4,5-b]pyridin-2-yl)sulfanylmethyl]phenyl]-(3-methylpiperidin-1-yl)methanone;oxalic acid.
| Compound Name | [4-[(3-benzylimidazo[4,5-b]pyridin-2-yl)sulfanylmethyl]phenyl]-(3-methylpiperidin-1-yl)methanone;oxalic acid |
|---|---|
| PubChem CID | 146051882 |
| Molecular Formula | C29H30N4O5S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | [4-[(3-benzylimidazo[4,5-b]pyridin-2-yl)sulfanylmethyl]phenyl]-(3-methylpiperidin-1-yl)methanone;oxalic acid |
| SMILES | CC1CCCN(C(=O)c2ccc(CSc3nc4cccnc4n3Cc3ccccc3)cc2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H28N4OS.C2H2O4/c1-20-7-6-16-30(17-20)26(32)23-13-11-22(12-14-23)19-33-27-29-24-10-5-15-28-25(24)31(27)18-21-8-3-2-4-9-21;3-1(4)2(5)6/h2-5,8-15,20H,6-7,16-19H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JJNUXZGQXPCLEP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|