C22H22N4OS — CID 3244121
2-(3-benzyl-4-oxo-6-piperidin-1-ylquinazolin-2-yl)sulfanylacetonitrile (PubChem CID 3244121) has the molecular formula C22H22N4OS and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-(3-benzyl-4-oxo-6-piperidin-1-ylquinazolin-2-yl)sulfanylacetonitrile.
| Compound Name | 2-(3-benzyl-4-oxo-6-piperidin-1-ylquinazolin-2-yl)sulfanylacetonitrile |
|---|---|
| PubChem CID | 3244121 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-(3-benzyl-4-oxo-6-piperidin-1-ylquinazolin-2-yl)sulfanylacetonitrile |
| SMILES | N#CCSc1nc2ccc(N3CCCCC3)cc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C22H22N4OS/c23-11-14-28-22-24-20-10-9-18(25-12-5-2-6-13-25)15-19(20)21(27)26(22)16-17-7-3-1-4-8-17/h1,3-4,7-10,15H,2,5-6,12-14,16H2 |
| InChIKey | ODOKSMLEXKTXEG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |