C31H34N4O3S — CID 5189516
2-(3-benzyl-4-oxo-6-piperidin-1-ylquinazolin-2-yl)sulfanyl-N-(2-methoxyphenyl)butanamide (PubChem CID 5189516) has the molecular formula C31H34N4O3S and a molecular weight of 542.71 g/mol. Its IUPAC name is 2-(3-benzyl-4-oxo-6-piperidin-1-ylquinazolin-2-yl)sulfanyl-N-(2-methoxyphenyl)butanamide.
| Compound Name | 2-(3-benzyl-4-oxo-6-piperidin-1-ylquinazolin-2-yl)sulfanyl-N-(2-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 5189516 |
| Molecular Formula | C31H34N4O3S |
| Molecular Weight | 542.71 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 2-(3-benzyl-4-oxo-6-piperidin-1-ylquinazolin-2-yl)sulfanyl-N-(2-methoxyphenyl)butanamide |
| SMILES | CCC(Sc1nc2ccc(N3CCCCC3)cc2c(=O)n1Cc1ccccc1)C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C31H34N4O3S/c1-3-28(29(36)32-26-14-8-9-15-27(26)38-2)39-31-33-25-17-16-23(34-18-10-5-11-19-34)20-24(25)30(37)35(31)21-22-12-6-4-7-13-22/h4,6-9,12-17,20,28H,3,5,10-11,18-19,21H2,1-2H3,(H,32,36) |
| InChIKey | FKHBIZOMEYAINQ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.71 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |