C30H37N3O5S — CID 46370189
2-[3-[2-(cyclohexen-1-yl)ethyl]-6,7-dimethoxy-4-oxoquinazolin-2-yl]sulfanyl-N-(2-ethoxyphenyl)butanamide (PubChem CID 46370189) has the molecular formula C30H37N3O5S and a molecular weight of 551.71 g/mol. Its IUPAC name is 2-[3-[2-(cyclohexen-1-yl)ethyl]-6,7-dimethoxy-4-oxoquinazolin-2-yl]sulfanyl-N-(2-ethoxyphenyl)butanamide.
| Compound Name | 2-[3-[2-(cyclohexen-1-yl)ethyl]-6,7-dimethoxy-4-oxoquinazolin-2-yl]sulfanyl-N-(2-ethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 46370189 |
| Molecular Formula | C30H37N3O5S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 2-[3-[2-(cyclohexen-1-yl)ethyl]-6,7-dimethoxy-4-oxoquinazolin-2-yl]sulfanyl-N-(2-ethoxyphenyl)butanamide |
| SMILES | CCOc1ccccc1NC(=O)C(CC)Sc1nc2cc(OC)c(OC)cc2c(=O)n1CCC1=CCCCC1 |
| InChI | InChI=1S/C30H37N3O5S/c1-5-27(28(34)31-22-14-10-11-15-24(22)38-6-2)39-30-32-23-19-26(37-4)25(36-3)18-21(23)29(35)33(30)17-16-20-12-8-7-9-13-20/h10-12,14-15,18-19,27H,5-9,13,16-17H2,1-4H3,(H,31,34) |
| InChIKey | UCVIXQZIYNORIA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|