C23H30N4O5S — CID 41297643
(2R)-2-[3-[2-(cyclohexen-1-yl)ethyl]-6,7-dimethoxy-4-oxoquinazolin-2-yl]sulfanyl-N-(methylcarbamoyl)propanamide (PubChem CID 41297643) has the molecular formula C23H30N4O5S and a molecular weight of 474.58 g/mol. Its IUPAC name is (2R)-2-[3-[2-(cyclohexen-1-yl)ethyl]-6,7-dimethoxy-4-oxoquinazolin-2-yl]sulfanyl-N-(methylcarbamoyl)propanamide.
| Compound Name | (2R)-2-[3-[2-(cyclohexen-1-yl)ethyl]-6,7-dimethoxy-4-oxoquinazolin-2-yl]sulfanyl-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 41297643 |
| Molecular Formula | C23H30N4O5S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | (2R)-2-[3-[2-(cyclohexen-1-yl)ethyl]-6,7-dimethoxy-4-oxoquinazolin-2-yl]sulfanyl-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)[C@@H](C)Sc1nc2cc(OC)c(OC)cc2c(=O)n1CCC1=CCCCC1 |
| InChI | InChI=1S/C23H30N4O5S/c1-14(20(28)26-22(30)24-2)33-23-25-17-13-19(32-4)18(31-3)12-16(17)21(29)27(23)11-10-15-8-6-5-7-9-15/h8,12-14H,5-7,9-11H2,1-4H3,(H2,24,26,28,30)/t14-/m1/s1 |
| InChIKey | QSCPOXZHCCTHPG-CQSZACIVSA-N |
| XLogP | 3.24 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|