C19H22BrN3O2S — CID 112785413
2-[6-bromo-3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylpropanamide (PubChem CID 112785413) has the molecular formula C19H22BrN3O2S and a molecular weight of 436.38 g/mol. Its IUPAC name is 2-[6-bromo-3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylpropanamide.
| Compound Name | 2-[6-bromo-3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 112785413 |
| Molecular Formula | C19H22BrN3O2S |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 2-[6-bromo-3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylpropanamide |
| SMILES | CC(Sc1nc2ccc(Br)cc2c(=O)n1CCC1=CCCCC1)C(N)=O |
| InChI | InChI=1S/C19H22BrN3O2S/c1-12(17(21)24)26-19-22-16-8-7-14(20)11-15(16)18(25)23(19)10-9-13-5-3-2-4-6-13/h5,7-8,11-12H,2-4,6,9-10H2,1H3,(H2,21,24) |
| InChIKey | HIERLCHSCKJGTI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|