C26H25N5O2S — CID 27947366
2-[4-oxo-3-(pyridin-3-ylmethyl)quinazolin-2-yl]sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 27947366) has the molecular formula C26H25N5O2S and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-[4-oxo-3-(pyridin-3-ylmethyl)quinazolin-2-yl]sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[4-oxo-3-(pyridin-3-ylmethyl)quinazolin-2-yl]sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 27947366 |
| Molecular Formula | C26H25N5O2S |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-[4-oxo-3-(pyridin-3-ylmethyl)quinazolin-2-yl]sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1Cc1cccnc1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C26H25N5O2S/c32-24(28-20-9-11-21(12-10-20)30-14-3-4-15-30)18-34-26-29-23-8-2-1-7-22(23)25(33)31(26)17-19-6-5-13-27-16-19/h1-2,5-13,16H,3-4,14-15,17-18H2,(H,28,32) |
| InChIKey | BGMBJQVXAQPDRS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|