C24H26N4O2S — CID 27734552
N-[2-(cyclohexen-1-yl)ethyl]-2-[4-oxo-3-(pyridin-3-ylmethyl)quinazolin-2-yl]sulfanylacetamide (PubChem CID 27734552) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[4-oxo-3-(pyridin-3-ylmethyl)quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[4-oxo-3-(pyridin-3-ylmethyl)quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 27734552 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[4-oxo-3-(pyridin-3-ylmethyl)quinazolin-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1Cc1cccnc1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C24H26N4O2S/c29-22(26-14-12-18-7-2-1-3-8-18)17-31-24-27-21-11-5-4-10-20(21)23(30)28(24)16-19-9-6-13-25-15-19/h4-7,9-11,13,15H,1-3,8,12,14,16-17H2,(H,26,29) |
| InChIKey | TWFJXVRCSFOENG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|