C25H22N4O3S2 — CID 45353609
4-[2-[2-(1-cyano-2-phenylethyl)sulfanyl-4-oxoquinazolin-3-yl]ethyl]benzenesulfonamide (PubChem CID 45353609) has the molecular formula C25H22N4O3S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 4-[2-[2-(1-cyano-2-phenylethyl)sulfanyl-4-oxoquinazolin-3-yl]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[2-(1-cyano-2-phenylethyl)sulfanyl-4-oxoquinazolin-3-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 45353609 |
| Molecular Formula | C25H22N4O3S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 4-[2-[2-(1-cyano-2-phenylethyl)sulfanyl-4-oxoquinazolin-3-yl]ethyl]benzenesulfonamide |
| SMILES | N#CC(Cc1ccccc1)Sc1nc2ccccc2c(=O)n1CCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C25H22N4O3S2/c26-17-20(16-19-6-2-1-3-7-19)33-25-28-23-9-5-4-8-22(23)24(30)29(25)15-14-18-10-12-21(13-11-18)34(27,31)32/h1-13,20H,14-16H2,(H2,27,31,32) |
| InChIKey | PZMXCJJQNNBJKH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |