C24H22N4O4S2 — CID 165417008
2-[4-oxo-3-[(4-sulfamoylphenyl)methyl]quinazolin-2-yl]sulfanyl-N-phenylpropanamide (PubChem CID 165417008) has the molecular formula C24H22N4O4S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is 2-[4-oxo-3-[(4-sulfamoylphenyl)methyl]quinazolin-2-yl]sulfanyl-N-phenylpropanamide.
| Compound Name | 2-[4-oxo-3-[(4-sulfamoylphenyl)methyl]quinazolin-2-yl]sulfanyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 165417008 |
| Molecular Formula | C24H22N4O4S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 2-[4-oxo-3-[(4-sulfamoylphenyl)methyl]quinazolin-2-yl]sulfanyl-N-phenylpropanamide |
| SMILES | CC(Sc1nc2ccccc2c(=O)n1Cc1ccc(S(N)(=O)=O)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H22N4O4S2/c1-16(22(29)26-18-7-3-2-4-8-18)33-24-27-21-10-6-5-9-20(21)23(30)28(24)15-17-11-13-19(14-12-17)34(25,31)32/h2-14,16H,15H2,1H3,(H,26,29)(H2,25,31,32) |
| InChIKey | QQKVYULOGMFXRM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |