C13H14N2O3S — CID 9066303
methyl 3-(2-methylsulfanyl-4-oxoquinazolin-3-yl)propanoate (PubChem CID 9066303) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is methyl 3-(2-methylsulfanyl-4-oxoquinazolin-3-yl)propanoate.
| Compound Name | methyl 3-(2-methylsulfanyl-4-oxoquinazolin-3-yl)propanoate |
|---|---|
| PubChem CID | 9066303 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | methyl 3-(2-methylsulfanyl-4-oxoquinazolin-3-yl)propanoate |
| SMILES | COC(=O)CCn1c(SC)nc2ccccc2c1=O |
| InChI | InChI=1S/C13H14N2O3S/c1-18-11(16)7-8-15-12(17)9-5-3-4-6-10(9)14-13(15)19-2/h3-6H,7-8H2,1-2H3 |
| InChIKey | QDPXKCKDEJNZTR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |