C15H17N3O4S — CID 7644775
methyl 3-[2-[(2S)-1-amino-1-oxopropan-2-yl]sulfanyl-4-oxoquinazolin-3-yl]propanoate (PubChem CID 7644775) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is methyl 3-[2-[(2S)-1-amino-1-oxopropan-2-yl]sulfanyl-4-oxoquinazolin-3-yl]propanoate.
| Compound Name | methyl 3-[2-[(2S)-1-amino-1-oxopropan-2-yl]sulfanyl-4-oxoquinazolin-3-yl]propanoate |
|---|---|
| PubChem CID | 7644775 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | methyl 3-[2-[(2S)-1-amino-1-oxopropan-2-yl]sulfanyl-4-oxoquinazolin-3-yl]propanoate |
| SMILES | COC(=O)CCn1c(S[C@@H](C)C(N)=O)nc2ccccc2c1=O |
| InChI | InChI=1S/C15H17N3O4S/c1-9(13(16)20)23-15-17-11-6-4-3-5-10(11)14(21)18(15)8-7-12(19)22-2/h3-6,9H,7-8H2,1-2H3,(H2,16,20)/t9-/m0/s1 |
| InChIKey | LWFUBLZQURWUNF-VIFPVBQESA-N |
| XLogP | 0.93 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |