C18H21N3O4S — CID 9000552
methyl 3-[4-oxo-2-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylquinazolin-3-yl]propanoate (PubChem CID 9000552) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is methyl 3-[4-oxo-2-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylquinazolin-3-yl]propanoate.
| Compound Name | methyl 3-[4-oxo-2-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylquinazolin-3-yl]propanoate |
|---|---|
| PubChem CID | 9000552 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | methyl 3-[4-oxo-2-[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylquinazolin-3-yl]propanoate |
| SMILES | C=CCNC(=O)[C@H](C)Sc1nc2ccccc2c(=O)n1CCC(=O)OC |
| InChI | InChI=1S/C18H21N3O4S/c1-4-10-19-16(23)12(2)26-18-20-14-8-6-5-7-13(14)17(24)21(18)11-9-15(22)25-3/h4-8,12H,1,9-11H2,2-3H3,(H,19,23)/t12-/m0/s1 |
| InChIKey | DHJXUPPKXXCVIL-LBPRGKRZSA-N |
| XLogP | 1.74 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|