C20H29N4O2S+ — CID 8882771
diethyl-[2-[4-oxo-2-[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylquinazolin-3-yl]ethyl]azanium (PubChem CID 8882771) has the molecular formula C20H29N4O2S+ and a molecular weight of 389.55 g/mol. Its IUPAC name is diethyl-[2-[4-oxo-2-[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylquinazolin-3-yl]ethyl]azanium.
| Compound Name | diethyl-[2-[4-oxo-2-[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylquinazolin-3-yl]ethyl]azanium |
|---|---|
| PubChem CID | 8882771 |
| Molecular Formula | C20H29N4O2S+ |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | diethyl-[2-[4-oxo-2-[(2R)-1-oxo-1-(prop-2-enylamino)propan-2-yl]sulfanylquinazolin-3-yl]ethyl]azanium |
| SMILES | C=CCNC(=O)[C@@H](C)Sc1nc2ccccc2c(=O)n1CC[NH+](CC)CC |
| InChI | InChI=1S/C20H28N4O2S/c1-5-12-21-18(25)15(4)27-20-22-17-11-9-8-10-16(17)19(26)24(20)14-13-23(6-2)7-3/h5,8-11,15H,1,6-7,12-14H2,2-4H3,(H,21,25)/p+1/t15-/m1/s1 |
| InChIKey | RUAKDWFOSRKYBJ-OAHLLOKOSA-O |
| XLogP | 1.10 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|