C24H27FN4O2S2 — CID 42743884
2-[[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylmethylsulfanyl]-N-(2-piperidin-1-ylethyl)acetamide (PubChem CID 42743884) has the molecular formula C24H27FN4O2S2 and a molecular weight of 486.64 g/mol. Its IUPAC name is 2-[[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylmethylsulfanyl]-N-(2-piperidin-1-ylethyl)acetamide.
| Compound Name | 2-[[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylmethylsulfanyl]-N-(2-piperidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 42743884 |
| Molecular Formula | C24H27FN4O2S2 |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 2-[[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylmethylsulfanyl]-N-(2-piperidin-1-ylethyl)acetamide |
| SMILES | O=C(CSCSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1)NCCN1CCCCC1 |
| InChI | InChI=1S/C24H27FN4O2S2/c25-18-8-10-19(11-9-18)29-23(31)20-6-2-3-7-21(20)27-24(29)33-17-32-16-22(30)26-12-15-28-13-4-1-5-14-28/h2-3,6-11H,1,4-5,12-17H2,(H,26,30) |
| InChIKey | XLHJKLYDLMBYMH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|