C34H32FN3O2S — CID 42734563
N-(3,3-diphenylpropyl)-5-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanamide (PubChem CID 42734563) has the molecular formula C34H32FN3O2S and a molecular weight of 565.71 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-5-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanamide.
| Compound Name | N-(3,3-diphenylpropyl)-5-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanamide |
|---|---|
| PubChem CID | 42734563 |
| Molecular Formula | C34H32FN3O2S |
| Molecular Weight | 565.71 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | N-(3,3-diphenylpropyl)-5-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpentanamide |
| SMILES | O=C(CCCCSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H32FN3O2S/c35-27-18-20-28(21-19-27)38-33(40)30-15-7-8-16-31(30)37-34(38)41-24-10-9-17-32(39)36-23-22-29(25-11-3-1-4-12-25)26-13-5-2-6-14-26/h1-8,11-16,18-21,29H,9-10,17,22-24H2,(H,36,39) |
| InChIKey | WXWAAHSFZIENEC-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|