C26H23F2N3O2S — CID 42744056
N-(2-fluorophenyl)-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide (PubChem CID 42744056) has the molecular formula C26H23F2N3O2S and a molecular weight of 479.55 g/mol. Its IUPAC name is N-(2-fluorophenyl)-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide.
| Compound Name | N-(2-fluorophenyl)-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide |
|---|---|
| PubChem CID | 42744056 |
| Molecular Formula | C26H23F2N3O2S |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-(2-fluorophenyl)-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide |
| SMILES | O=C(CCCCCSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1)Nc1ccccc1F |
| InChI | InChI=1S/C26H23F2N3O2S/c27-18-13-15-19(16-14-18)31-25(33)20-8-3-5-10-22(20)30-26(31)34-17-7-1-2-12-24(32)29-23-11-6-4-9-21(23)28/h3-6,8-11,13-16H,1-2,7,12,17H2,(H,29,32) |
| InChIKey | SZXNBSRRQVFDED-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|