C22H24FN3O3S — CID 42744055
N-ethoxy-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide (PubChem CID 42744055) has the molecular formula C22H24FN3O3S and a molecular weight of 429.52 g/mol. Its IUPAC name is N-ethoxy-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide.
| Compound Name | N-ethoxy-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide |
|---|---|
| PubChem CID | 42744055 |
| Molecular Formula | C22H24FN3O3S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | N-ethoxy-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide |
| SMILES | CCONC(=O)CCCCCSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FN3O3S/c1-2-29-25-20(27)10-4-3-7-15-30-22-24-19-9-6-5-8-18(19)21(28)26(22)17-13-11-16(23)12-14-17/h5-6,8-9,11-14H,2-4,7,10,15H2,1H3,(H,25,27) |
| InChIKey | UUQPWWOXFLFYJI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|