C23H26FN3O2S — CID 42744037
6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-propylhexanamide (PubChem CID 42744037) has the molecular formula C23H26FN3O2S and a molecular weight of 427.55 g/mol. Its IUPAC name is 6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-propylhexanamide.
| Compound Name | 6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-propylhexanamide |
|---|---|
| PubChem CID | 42744037 |
| Molecular Formula | C23H26FN3O2S |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-propylhexanamide |
| SMILES | CCCNC(=O)CCCCCSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FN3O2S/c1-2-15-25-21(28)10-4-3-7-16-30-23-26-20-9-6-5-8-19(20)22(29)27(23)18-13-11-17(24)12-14-18/h5-6,8-9,11-14H,2-4,7,10,15-16H2,1H3,(H,25,28) |
| InChIKey | BFJHUINQAVXXIF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|