C28H26FN3O4S — CID 42744054
N-(1,3-benzodioxol-5-ylmethyl)-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide (PubChem CID 42744054) has the molecular formula C28H26FN3O4S and a molecular weight of 519.60 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide |
|---|---|
| PubChem CID | 42744054 |
| Molecular Formula | C28H26FN3O4S |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-6-[3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]sulfanylhexanamide |
| SMILES | O=C(CCCCCSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H26FN3O4S/c29-20-10-12-21(13-11-20)32-27(34)22-6-3-4-7-23(22)31-28(32)37-15-5-1-2-8-26(33)30-17-19-9-14-24-25(16-19)36-18-35-24/h3-4,6-7,9-14,16H,1-2,5,8,15,17-18H2,(H,30,33) |
| InChIKey | IQFVZAUBLXJRJI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|