C26H29N3O4S — CID 42738618
N-(1,3-benzodioxol-5-ylmethyl)-5-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanylpentanamide (PubChem CID 42738618) has the molecular formula C26H29N3O4S and a molecular weight of 479.60 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanylpentanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanylpentanamide |
|---|---|
| PubChem CID | 42738618 |
| Molecular Formula | C26H29N3O4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(5-benzyl-1,4-dimethyl-6-oxopyrimidin-2-yl)sulfanylpentanamide |
| SMILES | Cc1nc(SCCCCC(=O)NCc2ccc3c(c2)OCO3)n(C)c(=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C26H29N3O4S/c1-18-21(14-19-8-4-3-5-9-19)25(31)29(2)26(28-18)34-13-7-6-10-24(30)27-16-20-11-12-22-23(15-20)33-17-32-22/h3-5,8-9,11-12,15H,6-7,10,13-14,16-17H2,1-2H3,(H,27,30) |
| InChIKey | HIUXHWGVHLSXMX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|