C27H33N3O2S — CID 42739594
5-[1,4-dimethyl-5-[(3-methylphenyl)methyl]-6-oxopyrimidin-2-yl]sulfanyl-N-(3,4-dimethylphenyl)pentanamide (PubChem CID 42739594) has the molecular formula C27H33N3O2S and a molecular weight of 463.65 g/mol. Its IUPAC name is 5-[1,4-dimethyl-5-[(3-methylphenyl)methyl]-6-oxopyrimidin-2-yl]sulfanyl-N-(3,4-dimethylphenyl)pentanamide.
| Compound Name | 5-[1,4-dimethyl-5-[(3-methylphenyl)methyl]-6-oxopyrimidin-2-yl]sulfanyl-N-(3,4-dimethylphenyl)pentanamide |
|---|---|
| PubChem CID | 42739594 |
| Molecular Formula | C27H33N3O2S |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 5-[1,4-dimethyl-5-[(3-methylphenyl)methyl]-6-oxopyrimidin-2-yl]sulfanyl-N-(3,4-dimethylphenyl)pentanamide |
| SMILES | Cc1cccc(Cc2c(C)nc(SCCCCC(=O)Nc3ccc(C)c(C)c3)n(C)c2=O)c1 |
| InChI | InChI=1S/C27H33N3O2S/c1-18-9-8-10-22(15-18)17-24-21(4)28-27(30(5)26(24)32)33-14-7-6-11-25(31)29-23-13-12-19(2)20(3)16-23/h8-10,12-13,15-16H,6-7,11,14,17H2,1-5H3,(H,29,31) |
| InChIKey | HBYUXXXUXXIANJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|