C25H28FN3O2S — CID 42739296
N-(3,4-dimethylphenyl)-4-[5-[(2-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylbutanamide (PubChem CID 42739296) has the molecular formula C25H28FN3O2S and a molecular weight of 453.58 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-[5-[(2-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylbutanamide.
| Compound Name | N-(3,4-dimethylphenyl)-4-[5-[(2-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylbutanamide |
|---|---|
| PubChem CID | 42739296 |
| Molecular Formula | C25H28FN3O2S |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-[5-[(2-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylbutanamide |
| SMILES | Cc1ccc(NC(=O)CCCSc2nc(C)c(Cc3ccccc3F)c(=O)n2C)cc1C |
| InChI | InChI=1S/C25H28FN3O2S/c1-16-11-12-20(14-17(16)2)28-23(30)10-7-13-32-25-27-18(3)21(24(31)29(25)4)15-19-8-5-6-9-22(19)26/h5-6,8-9,11-12,14H,7,10,13,15H2,1-4H3,(H,28,30) |
| InChIKey | IJYMNVUQGIUEKA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|