C17H19FN2O3S — CID 42737916
4-[5-[(2-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylbutanoic acid (PubChem CID 42737916) has the molecular formula C17H19FN2O3S and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[5-[(2-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylbutanoic acid.
| Compound Name | 4-[5-[(2-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 42737916 |
| Molecular Formula | C17H19FN2O3S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-[5-[(2-fluorophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanylbutanoic acid |
| SMILES | Cc1nc(SCCCC(=O)O)n(C)c(=O)c1Cc1ccccc1F |
| InChI | InChI=1S/C17H19FN2O3S/c1-11-13(10-12-6-3-4-7-14(12)18)16(23)20(2)17(19-11)24-9-5-8-15(21)22/h3-4,6-7H,5,8-10H2,1-2H3,(H,21,22) |
| InChIKey | RBGAJHAXBHXLHW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|