C24H25BrFN3O2S — CID 42739707
5-[5-[(4-bromophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanyl-N-(4-fluorophenyl)pentanamide (PubChem CID 42739707) has the molecular formula C24H25BrFN3O2S and a molecular weight of 518.45 g/mol. Its IUPAC name is 5-[5-[(4-bromophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanyl-N-(4-fluorophenyl)pentanamide.
| Compound Name | 5-[5-[(4-bromophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanyl-N-(4-fluorophenyl)pentanamide |
|---|---|
| PubChem CID | 42739707 |
| Molecular Formula | C24H25BrFN3O2S |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | 5-[5-[(4-bromophenyl)methyl]-1,4-dimethyl-6-oxopyrimidin-2-yl]sulfanyl-N-(4-fluorophenyl)pentanamide |
| SMILES | Cc1nc(SCCCCC(=O)Nc2ccc(F)cc2)n(C)c(=O)c1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H25BrFN3O2S/c1-16-21(15-17-6-8-18(25)9-7-17)23(31)29(2)24(27-16)32-14-4-3-5-22(30)28-20-12-10-19(26)11-13-20/h6-13H,3-5,14-15H2,1-2H3,(H,28,30) |
| InChIKey | KHIYEBGQKGMESU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|