C22H31N3O2S — CID 42738911
N-butyl-4-[1,4-dimethyl-5-[(4-methylphenyl)methyl]-6-oxopyrimidin-2-yl]sulfanylbutanamide (PubChem CID 42738911) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is N-butyl-4-[1,4-dimethyl-5-[(4-methylphenyl)methyl]-6-oxopyrimidin-2-yl]sulfanylbutanamide.
| Compound Name | N-butyl-4-[1,4-dimethyl-5-[(4-methylphenyl)methyl]-6-oxopyrimidin-2-yl]sulfanylbutanamide |
|---|---|
| PubChem CID | 42738911 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-butyl-4-[1,4-dimethyl-5-[(4-methylphenyl)methyl]-6-oxopyrimidin-2-yl]sulfanylbutanamide |
| SMILES | CCCCNC(=O)CCCSc1nc(C)c(Cc2ccc(C)cc2)c(=O)n1C |
| InChI | InChI=1S/C22H31N3O2S/c1-5-6-13-23-20(26)8-7-14-28-22-24-17(3)19(21(27)25(22)4)15-18-11-9-16(2)10-12-18/h9-12H,5-8,13-15H2,1-4H3,(H,23,26) |
| InChIKey | TYWVNNWYDYIUAF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|