C26H32N4O2S — CID 42738904
5-[1,4-dimethyl-5-[(4-methylphenyl)methyl]-6-oxopyrimidin-2-yl]sulfanyl-N-(2-pyridin-2-ylethyl)pentanamide (PubChem CID 42738904) has the molecular formula C26H32N4O2S and a molecular weight of 464.64 g/mol. Its IUPAC name is 5-[1,4-dimethyl-5-[(4-methylphenyl)methyl]-6-oxopyrimidin-2-yl]sulfanyl-N-(2-pyridin-2-ylethyl)pentanamide.
| Compound Name | 5-[1,4-dimethyl-5-[(4-methylphenyl)methyl]-6-oxopyrimidin-2-yl]sulfanyl-N-(2-pyridin-2-ylethyl)pentanamide |
|---|---|
| PubChem CID | 42738904 |
| Molecular Formula | C26H32N4O2S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 5-[1,4-dimethyl-5-[(4-methylphenyl)methyl]-6-oxopyrimidin-2-yl]sulfanyl-N-(2-pyridin-2-ylethyl)pentanamide |
| SMILES | Cc1ccc(Cc2c(C)nc(SCCCCC(=O)NCCc3ccccn3)n(C)c2=O)cc1 |
| InChI | InChI=1S/C26H32N4O2S/c1-19-10-12-21(13-11-19)18-23-20(2)29-26(30(3)25(23)32)33-17-7-5-9-24(31)28-16-14-22-8-4-6-15-27-22/h4,6,8,10-13,15H,5,7,9,14,16-18H2,1-3H3,(H,28,31) |
| InChIKey | WQVLOWNPXLAUDL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|