C27H31Cl2N3O3S — CID 42658893
5-[5-benzyl-4-(methoxymethyl)-1-methyl-6-oxopyrimidin-2-yl]sulfanyl-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide (PubChem CID 42658893) has the molecular formula C27H31Cl2N3O3S and a molecular weight of 548.54 g/mol. Its IUPAC name is 5-[5-benzyl-4-(methoxymethyl)-1-methyl-6-oxopyrimidin-2-yl]sulfanyl-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide.
| Compound Name | 5-[5-benzyl-4-(methoxymethyl)-1-methyl-6-oxopyrimidin-2-yl]sulfanyl-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 42658893 |
| Molecular Formula | C27H31Cl2N3O3S |
| Molecular Weight | 548.54 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 5-[5-benzyl-4-(methoxymethyl)-1-methyl-6-oxopyrimidin-2-yl]sulfanyl-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide |
| SMILES | COCc1nc(SCCCCC(=O)NCCc2ccc(Cl)cc2Cl)n(C)c(=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C27H31Cl2N3O3S/c1-32-26(34)22(16-19-8-4-3-5-9-19)24(18-35-2)31-27(32)36-15-7-6-10-25(33)30-14-13-20-11-12-21(28)17-23(20)29/h3-5,8-9,11-12,17H,6-7,10,13-16,18H2,1-2H3,(H,30,33) |
| InChIKey | OTESQKVBSLPVAK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|