C21H24Cl2N4O2S — CID 42731043
N-[2-(2,4-dichlorophenyl)ethyl]-5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanamide (PubChem CID 42731043) has the molecular formula C21H24Cl2N4O2S and a molecular weight of 467.42 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 42731043 |
| Molecular Formula | C21H24Cl2N4O2S |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
| SMILES | CCn1c(SCCCCC(=O)NCCc2ccc(Cl)cc2Cl)nnc1-c1ccco1 |
| InChI | InChI=1S/C21H24Cl2N4O2S/c1-2-27-20(18-6-5-12-29-18)25-26-21(27)30-13-4-3-7-19(28)24-11-10-15-8-9-16(22)14-17(15)23/h5-6,8-9,12,14H,2-4,7,10-11,13H2,1H3,(H,24,28) |
| InChIKey | LHWAFBHVMFQFMY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|