C23H30N4O4S — CID 42731035
N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanamide (PubChem CID 42731035) has the molecular formula C23H30N4O4S and a molecular weight of 458.58 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 42731035 |
| Molecular Formula | C23H30N4O4S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
| SMILES | CCn1c(SCCCCC(=O)NCCc2ccc(OC)c(OC)c2)nnc1-c1ccco1 |
| InChI | InChI=1S/C23H30N4O4S/c1-4-27-22(19-8-7-14-31-19)25-26-23(27)32-15-6-5-9-21(28)24-13-12-17-10-11-18(29-2)20(16-17)30-3/h7-8,10-11,14,16H,4-6,9,12-13,15H2,1-3H3,(H,24,28) |
| InChIKey | GZRFHICAJOKYKI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|