C27H30N4O4S — CID 5112238
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide (PubChem CID 5112238) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 5112238 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-[[5-(furan-2-yl)-4-(2-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide |
| SMILES | COc1ccc(CCNC(=O)CCCSc2nnc(-c3ccco3)n2-c2ccccc2C)cc1OC |
| InChI | InChI=1S/C27H30N4O4S/c1-19-8-4-5-9-21(19)31-26(23-10-6-16-35-23)29-30-27(31)36-17-7-11-25(32)28-15-14-20-12-13-22(33-2)24(18-20)34-3/h4-6,8-10,12-13,16,18H,7,11,14-15,17H2,1-3H3,(H,28,32) |
| InChIKey | XIASXJZOQYVAEP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|