C23H30N4O3S — CID 42734456
4-[[5-(furan-2-yl)-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N,N-dipropylbutanamide (PubChem CID 42734456) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 4-[[5-(furan-2-yl)-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N,N-dipropylbutanamide.
| Compound Name | 4-[[5-(furan-2-yl)-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N,N-dipropylbutanamide |
|---|---|
| PubChem CID | 42734456 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-[[5-(furan-2-yl)-4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N,N-dipropylbutanamide |
| SMILES | CCCN(CCC)C(=O)CCCSc1nnc(-c2ccco2)n1-c1ccccc1OC |
| InChI | InChI=1S/C23H30N4O3S/c1-4-14-26(15-5-2)21(28)13-9-17-31-23-25-24-22(20-12-8-16-30-20)27(23)18-10-6-7-11-19(18)29-3/h6-8,10-12,16H,4-5,9,13-15,17H2,1-3H3 |
| InChIKey | PVNGAKDONKGMRL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 73.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|