C25H32N4O2S — CID 42741716
4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dipropylbutanamide (PubChem CID 42741716) has the molecular formula C25H32N4O2S and a molecular weight of 452.62 g/mol. Its IUPAC name is 4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dipropylbutanamide.
| Compound Name | 4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dipropylbutanamide |
|---|---|
| PubChem CID | 42741716 |
| Molecular Formula | C25H32N4O2S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N,N-dipropylbutanamide |
| SMILES | CCCN(CCC)C(=O)CCCSc1nnc(-c2cccc(OC)c2)n1-c1ccccc1 |
| InChI | InChI=1S/C25H32N4O2S/c1-4-16-28(17-5-2)23(30)15-10-18-32-25-27-26-24(20-11-9-14-22(19-20)31-3)29(25)21-12-7-6-8-13-21/h6-9,11-14,19H,4-5,10,15-18H2,1-3H3 |
| InChIKey | NSAFUROGCBQKIE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|