C33H32N4O2S — CID 5003154
N-(1,2-diphenylethyl)-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide (PubChem CID 5003154) has the molecular formula C33H32N4O2S and a molecular weight of 548.71 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide.
| Compound Name | N-(1,2-diphenylethyl)-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 5003154 |
| Molecular Formula | C33H32N4O2S |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | N-(1,2-diphenylethyl)-4-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]butanamide |
| SMILES | COc1cccc(-c2nnc(SCCCC(=O)NC(Cc3ccccc3)c3ccccc3)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C33H32N4O2S/c1-39-29-20-11-17-27(24-29)32-35-36-33(37(32)28-18-9-4-10-19-28)40-22-12-21-31(38)34-30(26-15-7-3-8-16-26)23-25-13-5-2-6-14-25/h2-11,13-20,24,30H,12,21-23H2,1H3,(H,34,38) |
| InChIKey | SUBOWPAVRLPGNR-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|