C24H30N4O2S — CID 5176411
N-butan-2-yl-5-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide (PubChem CID 5176411) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is N-butan-2-yl-5-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide.
| Compound Name | N-butan-2-yl-5-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 5176411 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-butan-2-yl-5-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
| SMILES | CCC(C)NC(=O)CCCCSc1nnc(-c2ccccc2)n1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H30N4O2S/c1-4-18(2)25-22(29)12-8-9-17-31-24-27-26-23(19-10-6-5-7-11-19)28(24)20-13-15-21(30-3)16-14-20/h5-7,10-11,13-16,18H,4,8-9,12,17H2,1-3H3,(H,25,29) |
| InChIKey | BYBJRGKJANAZRC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|