C18H19N3O2S — CID 78762972
3-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol (PubChem CID 78762972) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 3-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol.
| Compound Name | 3-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 78762972 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]propan-1-ol |
| SMILES | COc1ccc(-n2c(SCCCO)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c1-23-16-10-8-15(9-11-16)21-17(14-6-3-2-4-7-14)19-20-18(21)24-13-5-12-22/h2-4,6-11,22H,5,12-13H2,1H3 |
| InChIKey | YBUGEVLNOPPZJC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|