C25H25N3OS — CID 4244994
4-(4-ethoxyphenyl)-3-phenyl-5-(3-phenylpropylsulfanyl)-1,2,4-triazole (PubChem CID 4244994) has the molecular formula C25H25N3OS and a molecular weight of 415.56 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-3-phenyl-5-(3-phenylpropylsulfanyl)-1,2,4-triazole.
| Compound Name | 4-(4-ethoxyphenyl)-3-phenyl-5-(3-phenylpropylsulfanyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 4244994 |
| Molecular Formula | C25H25N3OS |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4-(4-ethoxyphenyl)-3-phenyl-5-(3-phenylpropylsulfanyl)-1,2,4-triazole |
| SMILES | CCOc1ccc(-n2c(SCCCc3ccccc3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3OS/c1-2-29-23-17-15-22(16-18-23)28-24(21-13-7-4-8-14-21)26-27-25(28)30-19-9-12-20-10-5-3-6-11-20/h3-8,10-11,13-18H,2,9,12,19H2,1H3 |
| InChIKey | DTEFGVTXXVZNSU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|