C25H24N4O2S — CID 2084517
4-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-1-phenylbutan-1-one (PubChem CID 2084517) has the molecular formula C25H24N4O2S and a molecular weight of 444.56 g/mol. Its IUPAC name is 4-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-1-phenylbutan-1-one.
| Compound Name | 4-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 2084517 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 4-[[4-(4-ethoxyphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-1-phenylbutan-1-one |
| SMILES | CCOc1ccc(-n2c(SCCCC(=O)c3ccccc3)nnc2-c2cccnc2)cc1 |
| InChI | InChI=1S/C25H24N4O2S/c1-2-31-22-14-12-21(13-15-22)29-24(20-10-6-16-26-18-20)27-28-25(29)32-17-7-11-23(30)19-8-4-3-5-9-19/h3-6,8-10,12-16,18H,2,7,11,17H2,1H3 |
| InChIKey | VEDZJECAZOAMHO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|