C23H20ClN3S — CID 7169015
3-(4-chlorophenyl)-4-phenyl-5-(3-phenylpropylsulfanyl)-1,2,4-triazole (PubChem CID 7169015) has the molecular formula C23H20ClN3S and a molecular weight of 405.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-phenyl-5-(3-phenylpropylsulfanyl)-1,2,4-triazole.
| Compound Name | 3-(4-chlorophenyl)-4-phenyl-5-(3-phenylpropylsulfanyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 7169015 |
| Molecular Formula | C23H20ClN3S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 3-(4-chlorophenyl)-4-phenyl-5-(3-phenylpropylsulfanyl)-1,2,4-triazole |
| SMILES | Clc1ccc(-c2nnc(SCCCc3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20ClN3S/c24-20-15-13-19(14-16-20)22-25-26-23(27(22)21-11-5-2-6-12-21)28-17-7-10-18-8-3-1-4-9-18/h1-6,8-9,11-16H,7,10,17H2 |
| InChIKey | PNFDZCVGELPMOO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|