C18H19N3S — CID 4006269
3-butylsulfanyl-4,5-diphenyl-1,2,4-triazole (PubChem CID 4006269) has the molecular formula C18H19N3S and a molecular weight of 309.44 g/mol. Its IUPAC name is 3-butylsulfanyl-4,5-diphenyl-1,2,4-triazole.
| Compound Name | 3-butylsulfanyl-4,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 4006269 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-butylsulfanyl-4,5-diphenyl-1,2,4-triazole |
| SMILES | CCCCSc1nnc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C18H19N3S/c1-2-3-14-22-18-20-19-17(15-10-6-4-7-11-15)21(18)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3 |
| InChIKey | UAYYGNHOCLXTJR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|